About (5R)-2,5-diphenyl-4,5-dihydro-1,3-oxazole
(5R)-2,5-diphenyl-4,5-dihydro-1,3-oxazole (PubChem CID 10911168) has the molecular formula C15H13NO
and a molecular weight of 223.28 g/mol. Its IUPAC name is (5R)-2,5-diphenyl-4,5-dihydro-1,3-oxazole.
Molecular Properties
| Compound Name | (5R)-2,5-diphenyl-4,5-dihydro-1,3-oxazole |
| PubChem CID | 10911168 |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | (5R)-2,5-diphenyl-4,5-dihydro-1,3-oxazole |
| SMILES | c1ccc(C2=NC[C@@H](c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C15H13NO/c1-3-7-12(8-4-1)14-11-16-15(17-14)13-9-5-2-6-10-13/h1-10,14H,11H2/t14-/m0/s1 |
| InChIKey | AORHJOUBDGUERJ-AWEZNQCLSA-N |
| XLogP | 3.20 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R)-2,5-diphenyl-4,5-dihydro-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-2,5-diphenyl-4,5-dihydro-1,3-oxazole?
The IUPAC name of (5R)-2,5-diphenyl-4,5-dihydro-1,3-oxazole (CID 10911168) is (5R)-2,5-diphenyl-4,5-dihydro-1,3-oxazole.
What is the SMILES notation for (5R)-2,5-diphenyl-4,5-dihydro-1,3-oxazole?
The canonical SMILES for (5R)-2,5-diphenyl-4,5-dihydro-1,3-oxazole is c1ccc(C2=NC[C@@H](c3ccccc3)O2)cc1.
What is the InChIKey of (5R)-2,5-diphenyl-4,5-dihydro-1,3-oxazole?
The InChIKey is AORHJOUBDGUERJ-AWEZNQCLSA-N. The full InChI is InChI=1S/C15H13NO/c1-3-7-12(8-4-1)14-11-16-15(17-14)13-9-5-2-6-10-13/h1-10,14H,11H2/t14-/m0/s1.
What are the key properties of (5R)-2,5-diphenyl-4,5-dihydro-1,3-oxazole?
(5R)-2,5-diphenyl-4,5-dihydro-1,3-oxazole has a molecular weight of 223.28 g/mol, XLogP of 3.20, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-2,5-diphenyl-4,5-dihydro-1,3-oxazole is sourced from PubChem (CID 10911168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).