C15H16Cl2N4O — CID 109111709
N-butan-2-yl-6-(3,4-dichloroanilino)pyridazine-3-carboxamide (PubChem CID 109111709) has the molecular formula C15H16Cl2N4O and a molecular weight of 339.23 g/mol. Its IUPAC name is N-butan-2-yl-6-(3,4-dichloroanilino)pyridazine-3-carboxamide.
| Compound Name | N-butan-2-yl-6-(3,4-dichloroanilino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109111709 |
| Molecular Formula | C15H16Cl2N4O |
| Molecular Weight | 339.23 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | N-butan-2-yl-6-(3,4-dichloroanilino)pyridazine-3-carboxamide |
| SMILES | CCC(C)NC(=O)c1ccc(Nc2ccc(Cl)c(Cl)c2)nn1 |
| InChI | InChI=1S/C15H16Cl2N4O/c1-3-9(2)18-15(22)13-6-7-14(21-20-13)19-10-4-5-11(16)12(17)8-10/h4-9H,3H2,1-2H3,(H,18,22)(H,19,21) |
| InChIKey | UASUVHBUJJZNDD-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.23 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |