C15H14F2N4O — CID 109112053
[6-(2,4-difluoroanilino)pyridazin-3-yl]-pyrrolidin-1-ylmethanone (PubChem CID 109112053) has the molecular formula C15H14F2N4O and a molecular weight of 304.30 g/mol. Its IUPAC name is [6-(2,4-difluoroanilino)pyridazin-3-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [6-(2,4-difluoroanilino)pyridazin-3-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 109112053 |
| Molecular Formula | C15H14F2N4O |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | [6-(2,4-difluoroanilino)pyridazin-3-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1ccc(Nc2ccc(F)cc2F)nn1)N1CCCC1 |
| InChI | InChI=1S/C15H14F2N4O/c16-10-3-4-12(11(17)9-10)18-14-6-5-13(19-20-14)15(22)21-7-1-2-8-21/h3-6,9H,1-2,7-8H2,(H,18,20) |
| InChIKey | UJWRHYPBIAHEIS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |