About (E,4S)-1,1-diethoxynon-5-en-2-yn-4-ol
(E,4S)-1,1-diethoxynon-5-en-2-yn-4-ol (PubChem CID 10911258) has the molecular formula C13H22O3
and a molecular weight of 226.32 g/mol. Its IUPAC name is (E,4S)-1,1-diethoxynon-5-en-2-yn-4-ol.
Molecular Properties
| Compound Name | (E,4S)-1,1-diethoxynon-5-en-2-yn-4-ol |
| PubChem CID | 10911258 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | (E,4S)-1,1-diethoxynon-5-en-2-yn-4-ol |
| SMILES | CCC/C=C/[C@H](O)C#CC(OCC)OCC |
| InChI | InChI=1S/C13H22O3/c1-4-7-8-9-12(14)10-11-13(15-5-2)16-6-3/h8-9,12-14H,4-7H2,1-3H3/b9-8+/t12-/m0/s1 |
| InChIKey | YVYOVCRUJBIOLA-BCPZQOPPSA-N |
| XLogP | 2.11 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (E,4S)-1,1-diethoxynon-5-en-2-yn-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,4S)-1,1-diethoxynon-5-en-2-yn-4-ol?
The IUPAC name of (E,4S)-1,1-diethoxynon-5-en-2-yn-4-ol (CID 10911258) is (E,4S)-1,1-diethoxynon-5-en-2-yn-4-ol.
What is the SMILES notation for (E,4S)-1,1-diethoxynon-5-en-2-yn-4-ol?
The canonical SMILES for (E,4S)-1,1-diethoxynon-5-en-2-yn-4-ol is CCC/C=C/[C@H](O)C#CC(OCC)OCC.
What is the InChIKey of (E,4S)-1,1-diethoxynon-5-en-2-yn-4-ol?
The InChIKey is YVYOVCRUJBIOLA-BCPZQOPPSA-N. The full InChI is InChI=1S/C13H22O3/c1-4-7-8-9-12(14)10-11-13(15-5-2)16-6-3/h8-9,12-14H,4-7H2,1-3H3/b9-8+/t12-/m0/s1.
What are the key properties of (E,4S)-1,1-diethoxynon-5-en-2-yn-4-ol?
(E,4S)-1,1-diethoxynon-5-en-2-yn-4-ol has a molecular weight of 226.32 g/mol, XLogP of 2.11, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E,4S)-1,1-diethoxynon-5-en-2-yn-4-ol is sourced from PubChem (CID 10911258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).