C11H16O5 — CID 10911304
(3aS,6aS)-3a-(methoxymethoxymethyl)-2,2-dimethyl-6aH-cyclopenta[d][1,3]dioxol-4-one (PubChem CID 10911304) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is (3aS,6aS)-3a-(methoxymethoxymethyl)-2,2-dimethyl-6aH-cyclopenta[d][1,3]dioxol-4-one.
| Compound Name | (3aS,6aS)-3a-(methoxymethoxymethyl)-2,2-dimethyl-6aH-cyclopenta[d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 10911304 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (3aS,6aS)-3a-(methoxymethoxymethyl)-2,2-dimethyl-6aH-cyclopenta[d][1,3]dioxol-4-one |
| SMILES | COCOC[C@]12OC(C)(C)O[C@H]1C=CC2=O |
| InChI | InChI=1S/C11H16O5/c1-10(2)15-9-5-4-8(12)11(9,16-10)6-14-7-13-3/h4-5,9H,6-7H2,1-3H3/t9-,11+/m0/s1 |
| InChIKey | RTFCFLGPPXOHHD-GXSJLCMTSA-N |
| XLogP | 0.64 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|