About 3-methyl-5-(7-methyl-7-azoniabicyclo[2.2.1]heptan-1-yl)-1,2-oxazole chloride
3-methyl-5-(7-methyl-7-azoniabicyclo[2.2.1]heptan-1-yl)-1,2-oxazole chloride (PubChem CID 10911335) has the molecular formula C11H17ClN2O
and a molecular weight of 228.72 g/mol. Its IUPAC name is 3-methyl-5-(7-methyl-7-azoniabicyclo[2.2.1]heptan-1-yl)-1,2-oxazole chloride.
Molecular Properties
| Compound Name | 3-methyl-5-(7-methyl-7-azoniabicyclo[2.2.1]heptan-1-yl)-1,2-oxazole chloride |
| PubChem CID | 10911335 |
| Molecular Formula | C11H17ClN2O |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 3-methyl-5-(7-methyl-7-azoniabicyclo[2.2.1]heptan-1-yl)-1,2-oxazole chloride |
| SMILES | Cc1cc(C23CCC(CC2)[NH+]3C)on1.[Cl-] |
| InChI | InChI=1S/C11H16N2O.ClH/c1-8-7-10(14-12-8)11-5-3-9(4-6-11)13(11)2;/h7,9H,3-6H2,1-2H3;1H |
| InChIKey | GZHYLUFKBCQGFG-UHFFFAOYSA-N |
| XLogP | -2.35 |
| TPSA | 30.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-5-(7-methyl-7-azoniabicyclo[2.2.1]heptan-1-yl)-1,2-oxazole chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-(7-methyl-7-azoniabicyclo[2.2.1]heptan-1-yl)-1,2-oxazole chloride?
The IUPAC name of 3-methyl-5-(7-methyl-7-azoniabicyclo[2.2.1]heptan-1-yl)-1,2-oxazole chloride (CID 10911335) is 3-methyl-5-(7-methyl-7-azoniabicyclo[2.2.1]heptan-1-yl)-1,2-oxazole chloride.
What is the SMILES notation for 3-methyl-5-(7-methyl-7-azoniabicyclo[2.2.1]heptan-1-yl)-1,2-oxazole chloride?
The canonical SMILES for 3-methyl-5-(7-methyl-7-azoniabicyclo[2.2.1]heptan-1-yl)-1,2-oxazole chloride is Cc1cc(C23CCC(CC2)[NH+]3C)on1.[Cl-].
What is the InChIKey of 3-methyl-5-(7-methyl-7-azoniabicyclo[2.2.1]heptan-1-yl)-1,2-oxazole chloride?
The InChIKey is GZHYLUFKBCQGFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O.ClH/c1-8-7-10(14-12-8)11-5-3-9(4-6-11)13(11)2;/h7,9H,3-6H2,1-2H3;1H.
What are the key properties of 3-methyl-5-(7-methyl-7-azoniabicyclo[2.2.1]heptan-1-yl)-1,2-oxazole chloride?
3-methyl-5-(7-methyl-7-azoniabicyclo[2.2.1]heptan-1-yl)-1,2-oxazole chloride has a molecular weight of 228.72 g/mol, XLogP of -2.35, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-(7-methyl-7-azoniabicyclo[2.2.1]heptan-1-yl)-1,2-oxazole chloride is sourced from PubChem (CID 10911335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).