C17H20N4O4 — CID 109114237
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-(3-methoxypropylamino)pyridazine-3-carboxamide (PubChem CID 109114237) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-(3-methoxypropylamino)pyridazine-3-carboxamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-(3-methoxypropylamino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109114237 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-(3-methoxypropylamino)pyridazine-3-carboxamide |
| SMILES | COCCCNc1ccc(C(=O)Nc2ccc3c(c2)OCCO3)nn1 |
| InChI | InChI=1S/C17H20N4O4/c1-23-8-2-7-18-16-6-4-13(20-21-16)17(22)19-12-3-5-14-15(11-12)25-10-9-24-14/h3-6,11H,2,7-10H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | MKBBKZGELKTMCB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|