C16H19ClN4O3 — CID 109114375
6-(5-chloro-2-methoxyanilino)-N-(3-methoxypropyl)pyridazine-3-carboxamide (PubChem CID 109114375) has the molecular formula C16H19ClN4O3 and a molecular weight of 350.81 g/mol. Its IUPAC name is 6-(5-chloro-2-methoxyanilino)-N-(3-methoxypropyl)pyridazine-3-carboxamide.
| Compound Name | 6-(5-chloro-2-methoxyanilino)-N-(3-methoxypropyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109114375 |
| Molecular Formula | C16H19ClN4O3 |
| Molecular Weight | 350.81 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 6-(5-chloro-2-methoxyanilino)-N-(3-methoxypropyl)pyridazine-3-carboxamide |
| SMILES | COCCCNC(=O)c1ccc(Nc2cc(Cl)ccc2OC)nn1 |
| InChI | InChI=1S/C16H19ClN4O3/c1-23-9-3-8-18-16(22)12-5-7-15(21-20-12)19-13-10-11(17)4-6-14(13)24-2/h4-7,10H,3,8-9H2,1-2H3,(H,18,22)(H,19,21) |
| InChIKey | RYGHZAGQODTPKX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.81 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|