C13H15NO3 — CID 10911451
(1R,2S,5R,6R,8R,11S)-2-ethenyl-4-methyl-9-oxa-4-azatetracyclo[6.3.1.02,6.05,11]dodecane-3,7-dione (PubChem CID 10911451) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is (1R,2S,5R,6R,8R,11S)-2-ethenyl-4-methyl-9-oxa-4-azatetracyclo[6.3.1.02,6.05,11]dodecane-3,7-dione.
| Compound Name | (1R,2S,5R,6R,8R,11S)-2-ethenyl-4-methyl-9-oxa-4-azatetracyclo[6.3.1.02,6.05,11]dodecane-3,7-dione |
|---|---|
| PubChem CID | 10911451 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | (1R,2S,5R,6R,8R,11S)-2-ethenyl-4-methyl-9-oxa-4-azatetracyclo[6.3.1.02,6.05,11]dodecane-3,7-dione |
| SMILES | C=C[C@]12C(=O)N(C)[C@@H]3[C@H]4CO[C@H](C[C@H]41)C(=O)[C@@H]32 |
| InChI | InChI=1S/C13H15NO3/c1-3-13-7-4-8-11(15)9(13)10(6(7)5-17-8)14(2)12(13)16/h3,6-10H,1,4-5H2,2H3/t6-,7+,8+,9+,10+,13-/m0/s1 |
| InChIKey | VVUHPZOEEGILEN-JCZKDEQYSA-N |
| XLogP | 0.23 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|