C17H20N4O4 — CID 109114560
N-(3,4-dimethoxyphenyl)-6-morpholin-4-ylpyridazine-3-carboxamide (PubChem CID 109114560) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-6-morpholin-4-ylpyridazine-3-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-6-morpholin-4-ylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109114560 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-6-morpholin-4-ylpyridazine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc(N3CCOCC3)nn2)cc1OC |
| InChI | InChI=1S/C17H20N4O4/c1-23-14-5-3-12(11-15(14)24-2)18-17(22)13-4-6-16(20-19-13)21-7-9-25-10-8-21/h3-6,11H,7-10H2,1-2H3,(H,18,22) |
| InChIKey | RYXUNLXNSXZWTR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |