C10H18O6 — CID 10911468
(1S,3R,4R,5S)-1,3,4-trihydroxy-5-(2-hydroxypropyl)cyclohexane-1-carboxylic acid (PubChem CID 10911468) has the molecular formula C10H18O6 and a molecular weight of 234.25 g/mol. Its IUPAC name is (1S,3R,4R,5S)-1,3,4-trihydroxy-5-(2-hydroxypropyl)cyclohexane-1-carboxylic acid.
| Compound Name | (1S,3R,4R,5S)-1,3,4-trihydroxy-5-(2-hydroxypropyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 10911468 |
| Molecular Formula | C10H18O6 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | (1S,3R,4R,5S)-1,3,4-trihydroxy-5-(2-hydroxypropyl)cyclohexane-1-carboxylic acid |
| SMILES | CC(O)C[C@H]1C[C@@](O)(C(=O)O)C[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H18O6/c1-5(11)2-6-3-10(16,9(14)15)4-7(12)8(6)13/h5-8,11-13,16H,2-4H2,1H3,(H,14,15)/t5?,6-,7+,8+,10-/m0/s1 |
| InChIKey | QGGFZVLBSWQCDY-JEZNZZIDSA-N |
| XLogP | -1.30 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |