C14H20O3 — CID 10911548
ethyl (3aS,6R,7aS)-6-ethyl-1-oxo-2,3,3a,6,7,7a-hexahydroindene-4-carboxylate (PubChem CID 10911548) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is ethyl (3aS,6R,7aS)-6-ethyl-1-oxo-2,3,3a,6,7,7a-hexahydroindene-4-carboxylate.
| Compound Name | ethyl (3aS,6R,7aS)-6-ethyl-1-oxo-2,3,3a,6,7,7a-hexahydroindene-4-carboxylate |
|---|---|
| PubChem CID | 10911548 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | ethyl (3aS,6R,7aS)-6-ethyl-1-oxo-2,3,3a,6,7,7a-hexahydroindene-4-carboxylate |
| SMILES | CCOC(=O)C1=C[C@H](CC)C[C@@H]2C(=O)CC[C@H]12 |
| InChI | InChI=1S/C14H20O3/c1-3-9-7-11-10(5-6-13(11)15)12(8-9)14(16)17-4-2/h8-11H,3-7H2,1-2H3/t9-,10+,11+/m1/s1 |
| InChIKey | BOASRUCRIQNJSE-VWYCJHECSA-N |
| XLogP | 2.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |