C15H26O2 — CID 10911607
2-[(1aS,4aS,7R,8aR)-1a,4a-dimethyl-3,4,5,6,7,8-hexahydro-2H-naphtho[1,8a-b]oxiren-7-yl]propan-2-ol (PubChem CID 10911607) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is 2-[(1aS,4aS,7R,8aR)-1a,4a-dimethyl-3,4,5,6,7,8-hexahydro-2H-naphtho[1,8a-b]oxiren-7-yl]propan-2-ol.
| Compound Name | 2-[(1aS,4aS,7R,8aR)-1a,4a-dimethyl-3,4,5,6,7,8-hexahydro-2H-naphtho[1,8a-b]oxiren-7-yl]propan-2-ol |
|---|---|
| PubChem CID | 10911607 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 2-[(1aS,4aS,7R,8aR)-1a,4a-dimethyl-3,4,5,6,7,8-hexahydro-2H-naphtho[1,8a-b]oxiren-7-yl]propan-2-ol |
| SMILES | CC(C)(O)[C@@H]1CC[C@]2(C)CCC[C@]3(C)O[C@]23C1 |
| InChI | InChI=1S/C15H26O2/c1-12(2,16)11-6-9-13(3)7-5-8-14(4)15(13,10-11)17-14/h11,16H,5-10H2,1-4H3/t11-,13+,14+,15-/m1/s1 |
| InChIKey | ZGMFFZYUZKZDRL-UQOMUDLDSA-N |
| XLogP | 3.28 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|