C9H18O3S2 — CID 10911610
(2S,3R,4R)-4-(1,3-dithian-2-yl)-3-methylbutane-1,2,4-triol (PubChem CID 10911610) has the molecular formula C9H18O3S2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (2S,3R,4R)-4-(1,3-dithian-2-yl)-3-methylbutane-1,2,4-triol.
| Compound Name | (2S,3R,4R)-4-(1,3-dithian-2-yl)-3-methylbutane-1,2,4-triol |
|---|---|
| PubChem CID | 10911610 |
| Molecular Formula | C9H18O3S2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | (2S,3R,4R)-4-(1,3-dithian-2-yl)-3-methylbutane-1,2,4-triol |
| SMILES | C[C@H]([C@H](O)CO)[C@@H](O)C1SCCCS1 |
| InChI | InChI=1S/C9H18O3S2/c1-6(7(11)5-10)8(12)9-13-3-2-4-14-9/h6-12H,2-5H2,1H3/t6-,7-,8-/m1/s1 |
| InChIKey | CGEALQXCOHVJSN-BWZBUEFSSA-N |
| XLogP | 0.53 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |