About dibenzothiophene-4,6-dicarbaldehyde
dibenzothiophene-4,6-dicarbaldehyde (PubChem CID 10911644) has the molecular formula C14H8O2S
and a molecular weight of 240.28 g/mol. Its IUPAC name is dibenzothiophene-4,6-dicarbaldehyde.
Molecular Properties
| Compound Name | dibenzothiophene-4,6-dicarbaldehyde |
| PubChem CID | 10911644 |
| Molecular Formula | C14H8O2S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | dibenzothiophene-4,6-dicarbaldehyde |
| SMILES | O=Cc1cccc2c1sc1c(C=O)cccc12 |
| InChI | InChI=1S/C14H8O2S/c15-7-9-3-1-5-11-12-6-2-4-10(8-16)14(12)17-13(9)11/h1-8H |
| InChIKey | LFJZDTIEDRKBBA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze dibenzothiophene-4,6-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzothiophene-4,6-dicarbaldehyde?
The IUPAC name of dibenzothiophene-4,6-dicarbaldehyde (CID 10911644) is dibenzothiophene-4,6-dicarbaldehyde.
What is the SMILES notation for dibenzothiophene-4,6-dicarbaldehyde?
The canonical SMILES for dibenzothiophene-4,6-dicarbaldehyde is O=Cc1cccc2c1sc1c(C=O)cccc12.
What is the InChIKey of dibenzothiophene-4,6-dicarbaldehyde?
The InChIKey is LFJZDTIEDRKBBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8O2S/c15-7-9-3-1-5-11-12-6-2-4-10(8-16)14(12)17-13(9)11/h1-8H.
What are the key properties of dibenzothiophene-4,6-dicarbaldehyde?
dibenzothiophene-4,6-dicarbaldehyde has a molecular weight of 240.28 g/mol, XLogP of 3.68, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzothiophene-4,6-dicarbaldehyde is sourced from PubChem (CID 10911644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).