C14H16ClNO — CID 10911920
(4aS,10bR)-8-chloro-10b-methyl-1,2,4,4a,5,6-hexahydrobenzo[f]quinolin-3-one (PubChem CID 10911920) has the molecular formula C14H16ClNO and a molecular weight of 249.74 g/mol. Its IUPAC name is (4aS,10bR)-8-chloro-10b-methyl-1,2,4,4a,5,6-hexahydrobenzo[f]quinolin-3-one.
| Compound Name | (4aS,10bR)-8-chloro-10b-methyl-1,2,4,4a,5,6-hexahydrobenzo[f]quinolin-3-one |
|---|---|
| PubChem CID | 10911920 |
| Molecular Formula | C14H16ClNO |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | (4aS,10bR)-8-chloro-10b-methyl-1,2,4,4a,5,6-hexahydrobenzo[f]quinolin-3-one |
| SMILES | C[C@]12CCC(=O)N[C@H]1CCc1cc(Cl)ccc12 |
| InChI | InChI=1S/C14H16ClNO/c1-14-7-6-13(17)16-12(14)5-2-9-8-10(15)3-4-11(9)14/h3-4,8,12H,2,5-7H2,1H3,(H,16,17)/t12-,14+/m0/s1 |
| InChIKey | WSUXPPZGHUBBER-GXTWGEPZSA-N |
| XLogP | 2.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |