C18H16ClN5O2 — CID 109120732
N-(5-chloro-2-methoxyphenyl)-6-(pyridin-2-ylmethylamino)pyridazine-3-carboxamide (PubChem CID 109120732) has the molecular formula C18H16ClN5O2 and a molecular weight of 369.81 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-6-(pyridin-2-ylmethylamino)pyridazine-3-carboxamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-6-(pyridin-2-ylmethylamino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109120732 |
| Molecular Formula | C18H16ClN5O2 |
| Molecular Weight | 369.81 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-6-(pyridin-2-ylmethylamino)pyridazine-3-carboxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)c1ccc(NCc2ccccn2)nn1 |
| InChI | InChI=1S/C18H16ClN5O2/c1-26-16-7-5-12(19)10-15(16)22-18(25)14-6-8-17(24-23-14)21-11-13-4-2-3-9-20-13/h2-10H,11H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | BWRVGCQGQMFHJX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.81 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |