C13H10N2O2S — CID 10912191
5-(naphthalen-1-yloxymethyl)-3H-1,3,4-oxadiazole-2-thione (PubChem CID 10912191) has the molecular formula C13H10N2O2S and a molecular weight of 258.30 g/mol. Its IUPAC name is 5-(naphthalen-1-yloxymethyl)-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(naphthalen-1-yloxymethyl)-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 10912191 |
| Molecular Formula | C13H10N2O2S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 5-(naphthalen-1-yloxymethyl)-3H-1,3,4-oxadiazole-2-thione |
| SMILES | S=c1[nH]nc(COc2cccc3ccccc23)o1 |
| InChI | InChI=1S/C13H10N2O2S/c18-13-15-14-12(17-13)8-16-11-7-3-5-9-4-1-2-6-10(9)11/h1-7H,8H2,(H,15,18) |
| InChIKey | WCPWXKGQTRLLRU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|