C14H26O4 — CID 10912204
(1S)-1-[(2R,3aR,8aS)-2,5,5,8a-tetramethyl-3a,6,7,8-tetrahydro-3H-furo[3,2-b]oxepin-2-yl]ethane-1,2-diol (PubChem CID 10912204) has the molecular formula C14H26O4 and a molecular weight of 258.36 g/mol. Its IUPAC name is (1S)-1-[(2R,3aR,8aS)-2,5,5,8a-tetramethyl-3a,6,7,8-tetrahydro-3H-furo[3,2-b]oxepin-2-yl]ethane-1,2-diol.
| Compound Name | (1S)-1-[(2R,3aR,8aS)-2,5,5,8a-tetramethyl-3a,6,7,8-tetrahydro-3H-furo[3,2-b]oxepin-2-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 10912204 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | (1S)-1-[(2R,3aR,8aS)-2,5,5,8a-tetramethyl-3a,6,7,8-tetrahydro-3H-furo[3,2-b]oxepin-2-yl]ethane-1,2-diol |
| SMILES | CC1(C)CCC[C@]2(C)O[C@@](C)([C@@H](O)CO)C[C@H]2O1 |
| InChI | InChI=1S/C14H26O4/c1-12(2)6-5-7-13(3)11(17-12)8-14(4,18-13)10(16)9-15/h10-11,15-16H,5-9H2,1-4H3/t10-,11+,13-,14+/m0/s1 |
| InChIKey | UAGPGFRPQNGMIJ-UZGDPCLZSA-N |
| XLogP | 1.62 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |