C21H19FN4O3 — CID 109122187
methyl 2-[[6-[2-(4-fluorophenyl)ethylcarbamoyl]pyridazin-3-yl]amino]benzoate (PubChem CID 109122187) has the molecular formula C21H19FN4O3 and a molecular weight of 394.41 g/mol. Its IUPAC name is methyl 2-[[6-[2-(4-fluorophenyl)ethylcarbamoyl]pyridazin-3-yl]amino]benzoate.
| Compound Name | methyl 2-[[6-[2-(4-fluorophenyl)ethylcarbamoyl]pyridazin-3-yl]amino]benzoate |
|---|---|
| PubChem CID | 109122187 |
| Molecular Formula | C21H19FN4O3 |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | methyl 2-[[6-[2-(4-fluorophenyl)ethylcarbamoyl]pyridazin-3-yl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1Nc1ccc(C(=O)NCCc2ccc(F)cc2)nn1 |
| InChI | InChI=1S/C21H19FN4O3/c1-29-21(28)16-4-2-3-5-17(16)24-19-11-10-18(25-26-19)20(27)23-13-12-14-6-8-15(22)9-7-14/h2-11H,12-13H2,1H3,(H,23,27)(H,24,26) |
| InChIKey | LQSRZLOLWAECOE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |