C15H17NO3 — CID 10912236
(4aS,10bR)-8,9-dimethoxy-4,4a,5,10b-tetrahydro-1H-phenanthridin-6-one (PubChem CID 10912236) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is (4aS,10bR)-8,9-dimethoxy-4,4a,5,10b-tetrahydro-1H-phenanthridin-6-one.
| Compound Name | (4aS,10bR)-8,9-dimethoxy-4,4a,5,10b-tetrahydro-1H-phenanthridin-6-one |
|---|---|
| PubChem CID | 10912236 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (4aS,10bR)-8,9-dimethoxy-4,4a,5,10b-tetrahydro-1H-phenanthridin-6-one |
| SMILES | COc1cc2c(cc1OC)[C@H]1CC=CC[C@@H]1NC2=O |
| InChI | InChI=1S/C15H17NO3/c1-18-13-7-10-9-5-3-4-6-12(9)16-15(17)11(10)8-14(13)19-2/h3-4,7-9,12H,5-6H2,1-2H3,(H,16,17)/t9-,12+/m1/s1 |
| InChIKey | JAHNBYFVLUTQMQ-SKDRFNHKSA-N |
| XLogP | 2.25 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|