C22H25N5O2 — CID 109122510
N-[2-(4-methoxyphenyl)ethyl]-6-[methyl(2-pyridin-4-ylethyl)amino]pyridazine-3-carboxamide (PubChem CID 109122510) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)ethyl]-6-[methyl(2-pyridin-4-ylethyl)amino]pyridazine-3-carboxamide.
| Compound Name | N-[2-(4-methoxyphenyl)ethyl]-6-[methyl(2-pyridin-4-ylethyl)amino]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109122510 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | N-[2-(4-methoxyphenyl)ethyl]-6-[methyl(2-pyridin-4-ylethyl)amino]pyridazine-3-carboxamide |
| SMILES | COc1ccc(CCNC(=O)c2ccc(N(C)CCc3ccncc3)nn2)cc1 |
| InChI | InChI=1S/C22H25N5O2/c1-27(16-12-18-9-13-23-14-10-18)21-8-7-20(25-26-21)22(28)24-15-11-17-3-5-19(29-2)6-4-17/h3-10,13-14H,11-12,15-16H2,1-2H3,(H,24,28) |
| InChIKey | RAIFEFOCNCYUMH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |