C21H17F2N5O — CID 109123298
6-(2,6-difluoroanilino)-N-[2-(1H-indol-3-yl)ethyl]pyridazine-3-carboxamide (PubChem CID 109123298) has the molecular formula C21H17F2N5O and a molecular weight of 393.40 g/mol. Its IUPAC name is 6-(2,6-difluoroanilino)-N-[2-(1H-indol-3-yl)ethyl]pyridazine-3-carboxamide.
| Compound Name | 6-(2,6-difluoroanilino)-N-[2-(1H-indol-3-yl)ethyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109123298 |
| Molecular Formula | C21H17F2N5O |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 6-(2,6-difluoroanilino)-N-[2-(1H-indol-3-yl)ethyl]pyridazine-3-carboxamide |
| SMILES | O=C(NCCc1c[nH]c2ccccc12)c1ccc(Nc2c(F)cccc2F)nn1 |
| InChI | InChI=1S/C21H17F2N5O/c22-15-5-3-6-16(23)20(15)26-19-9-8-18(27-28-19)21(29)24-11-10-13-12-25-17-7-2-1-4-14(13)17/h1-9,12,25H,10-11H2,(H,24,29)(H,26,28) |
| InChIKey | WFVNUNHXHPLQNN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |