C16H29BO2 — CID 10912368
(4R,5R)-4,5-dicyclohexyl-2-ethyl-1,3,2-dioxaborolane (PubChem CID 10912368) has the molecular formula C16H29BO2 and a molecular weight of 264.22 g/mol. Its IUPAC name is (4R,5R)-4,5-dicyclohexyl-2-ethyl-1,3,2-dioxaborolane.
| Compound Name | (4R,5R)-4,5-dicyclohexyl-2-ethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 10912368 |
| Molecular Formula | C16H29BO2 |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | (4R,5R)-4,5-dicyclohexyl-2-ethyl-1,3,2-dioxaborolane |
| SMILES | CCB1O[C@H](C2CCCCC2)[C@@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C16H29BO2/c1-2-17-18-15(13-9-5-3-6-10-13)16(19-17)14-11-7-4-8-12-14/h13-16H,2-12H2,1H3/t15-,16-/m1/s1 |
| InChIKey | CPSCOPNVLILSKG-HZPDHXFCSA-N |
| XLogP | 4.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|