C16H24O3 — CID 10912391
(2R,5E,6R)-2-tert-butyl-5-(4,4-dimethylpent-2-ynylidene)-6-methyl-1,3-dioxan-4-one (PubChem CID 10912391) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is (2R,5E,6R)-2-tert-butyl-5-(4,4-dimethylpent-2-ynylidene)-6-methyl-1,3-dioxan-4-one.
| Compound Name | (2R,5E,6R)-2-tert-butyl-5-(4,4-dimethylpent-2-ynylidene)-6-methyl-1,3-dioxan-4-one |
|---|---|
| PubChem CID | 10912391 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (2R,5E,6R)-2-tert-butyl-5-(4,4-dimethylpent-2-ynylidene)-6-methyl-1,3-dioxan-4-one |
| SMILES | C[C@H]1O[C@@H](C(C)(C)C)OC(=O)/C1=C/C#CC(C)(C)C |
| InChI | InChI=1S/C16H24O3/c1-11-12(9-8-10-15(2,3)4)13(17)19-14(18-11)16(5,6)7/h9,11,14H,1-7H3/b12-9+/t11-,14-/m1/s1 |
| InChIKey | RRTQOQDASOXGQN-XEGJVCIASA-N |
| XLogP | 3.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|