C16H24O3 — CID 10912392
3,4-diethoxy-2,4-bis(2-methylprop-2-enyl)cyclobut-2-en-1-one (PubChem CID 10912392) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is 3,4-diethoxy-2,4-bis(2-methylprop-2-enyl)cyclobut-2-en-1-one.
| Compound Name | 3,4-diethoxy-2,4-bis(2-methylprop-2-enyl)cyclobut-2-en-1-one |
|---|---|
| PubChem CID | 10912392 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 3,4-diethoxy-2,4-bis(2-methylprop-2-enyl)cyclobut-2-en-1-one |
| SMILES | C=C(C)CC1=C(OCC)C(CC(=C)C)(OCC)C1=O |
| InChI | InChI=1S/C16H24O3/c1-7-18-15-13(9-11(3)4)14(17)16(15,19-8-2)10-12(5)6/h3,5,7-10H2,1-2,4,6H3 |
| InChIKey | OXJPHEGCHQLVKN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|