About (6Z)-6-(4-methylpent-3-enyl)-5,8-dihydrotetrathiocine
(6Z)-6-(4-methylpent-3-enyl)-5,8-dihydrotetrathiocine (PubChem CID 10912402) has the molecular formula C10H16S4
and a molecular weight of 264.51 g/mol. Its IUPAC name is (6Z)-6-(4-methylpent-3-enyl)-5,8-dihydrotetrathiocine.
Molecular Properties
| Compound Name | (6Z)-6-(4-methylpent-3-enyl)-5,8-dihydrotetrathiocine |
| PubChem CID | 10912402 |
| Molecular Formula | C10H16S4 |
| Molecular Weight | 264.51 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | (6Z)-6-(4-methylpent-3-enyl)-5,8-dihydrotetrathiocine |
| SMILES | CC(C)=CCC/C1=C/CSSSSC1 |
| InChI | InChI=1S/C10H16S4/c1-9(2)4-3-5-10-6-7-11-13-14-12-8-10/h4,6H,3,5,7-8H2,1-2H3/b10-6- |
| InChIKey | OKRAIIIRDYCGGZ-POHAHGRESA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.51 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6Z)-6-(4-methylpent-3-enyl)-5,8-dihydrotetrathiocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z)-6-(4-methylpent-3-enyl)-5,8-dihydrotetrathiocine?
The IUPAC name of (6Z)-6-(4-methylpent-3-enyl)-5,8-dihydrotetrathiocine (CID 10912402) is (6Z)-6-(4-methylpent-3-enyl)-5,8-dihydrotetrathiocine.
What is the SMILES notation for (6Z)-6-(4-methylpent-3-enyl)-5,8-dihydrotetrathiocine?
The canonical SMILES for (6Z)-6-(4-methylpent-3-enyl)-5,8-dihydrotetrathiocine is CC(C)=CCC/C1=C/CSSSSC1.
What is the InChIKey of (6Z)-6-(4-methylpent-3-enyl)-5,8-dihydrotetrathiocine?
The InChIKey is OKRAIIIRDYCGGZ-POHAHGRESA-N. The full InChI is InChI=1S/C10H16S4/c1-9(2)4-3-5-10-6-7-11-13-14-12-8-10/h4,6H,3,5,7-8H2,1-2H3/b10-6-.
What are the key properties of (6Z)-6-(4-methylpent-3-enyl)-5,8-dihydrotetrathiocine?
(6Z)-6-(4-methylpent-3-enyl)-5,8-dihydrotetrathiocine has a molecular weight of 264.51 g/mol, XLogP of 5.35, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z)-6-(4-methylpent-3-enyl)-5,8-dihydrotetrathiocine is sourced from PubChem (CID 10912402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).