C18H23ClN4O — CID 109125564
6-[butyl(methyl)amino]-N-[2-(3-chlorophenyl)ethyl]pyridazine-3-carboxamide (PubChem CID 109125564) has the molecular formula C18H23ClN4O and a molecular weight of 346.86 g/mol. Its IUPAC name is 6-[butyl(methyl)amino]-N-[2-(3-chlorophenyl)ethyl]pyridazine-3-carboxamide.
| Compound Name | 6-[butyl(methyl)amino]-N-[2-(3-chlorophenyl)ethyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109125564 |
| Molecular Formula | C18H23ClN4O |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 6-[butyl(methyl)amino]-N-[2-(3-chlorophenyl)ethyl]pyridazine-3-carboxamide |
| SMILES | CCCCN(C)c1ccc(C(=O)NCCc2cccc(Cl)c2)nn1 |
| InChI | InChI=1S/C18H23ClN4O/c1-3-4-12-23(2)17-9-8-16(21-22-17)18(24)20-11-10-14-6-5-7-15(19)13-14/h5-9,13H,3-4,10-12H2,1-2H3,(H,20,24) |
| InChIKey | KIIFNRNXWMJWPJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |