About 2,5-diphenyl-1λ4,3-dithiacyclopenta-1,5-dien-4-one
2,5-diphenyl-1λ4,3-dithiacyclopenta-1,5-dien-4-one (PubChem CID 10912590) has the molecular formula C15H10OS2
and a molecular weight of 270.38 g/mol. Its IUPAC name is 2,5-diphenyl-1λ4,3-dithiacyclopenta-1,5-dien-4-one.
Molecular Properties
| Compound Name | 2,5-diphenyl-1λ4,3-dithiacyclopenta-1,5-dien-4-one |
| PubChem CID | 10912590 |
| Molecular Formula | C15H10OS2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 2,5-diphenyl-1λ4,3-dithiacyclopenta-1,5-dien-4-one |
| SMILES | O=C1SC(c2ccccc2)=S=C1c1ccccc1 |
| InChI | InChI=1S/C15H10OS2/c16-14-13(11-7-3-1-4-8-11)17-15(18-14)12-9-5-2-6-10-12/h1-10H |
| InChIKey | FVWLMVCCZWCWBY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 2,5-diphenyl-1λ4,3-dithiacyclopenta-1,5-dien-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-diphenyl-1λ4,3-dithiacyclopenta-1,5-dien-4-one?
The IUPAC name of 2,5-diphenyl-1λ4,3-dithiacyclopenta-1,5-dien-4-one (CID 10912590) is 2,5-diphenyl-1λ4,3-dithiacyclopenta-1,5-dien-4-one.
What is the SMILES notation for 2,5-diphenyl-1λ4,3-dithiacyclopenta-1,5-dien-4-one?
The canonical SMILES for 2,5-diphenyl-1λ4,3-dithiacyclopenta-1,5-dien-4-one is O=C1SC(c2ccccc2)=S=C1c1ccccc1.
What is the InChIKey of 2,5-diphenyl-1λ4,3-dithiacyclopenta-1,5-dien-4-one?
The InChIKey is FVWLMVCCZWCWBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10OS2/c16-14-13(11-7-3-1-4-8-11)17-15(18-14)12-9-5-2-6-10-12/h1-10H.
What are the key properties of 2,5-diphenyl-1λ4,3-dithiacyclopenta-1,5-dien-4-one?
2,5-diphenyl-1λ4,3-dithiacyclopenta-1,5-dien-4-one has a molecular weight of 270.38 g/mol, XLogP of 3.39, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-diphenyl-1λ4,3-dithiacyclopenta-1,5-dien-4-one is sourced from PubChem (CID 10912590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).