C17H19BrN4O — CID 109126106
[6-(2-bromoanilino)pyridazin-3-yl]-(3-methylpiperidin-1-yl)methanone (PubChem CID 109126106) has the molecular formula C17H19BrN4O and a molecular weight of 375.27 g/mol. Its IUPAC name is [6-(2-bromoanilino)pyridazin-3-yl]-(3-methylpiperidin-1-yl)methanone.
| Compound Name | [6-(2-bromoanilino)pyridazin-3-yl]-(3-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 109126106 |
| Molecular Formula | C17H19BrN4O |
| Molecular Weight | 375.27 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | [6-(2-bromoanilino)pyridazin-3-yl]-(3-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCCN(C(=O)c2ccc(Nc3ccccc3Br)nn2)C1 |
| InChI | InChI=1S/C17H19BrN4O/c1-12-5-4-10-22(11-12)17(23)15-8-9-16(21-20-15)19-14-7-3-2-6-13(14)18/h2-3,6-9,12H,4-5,10-11H2,1H3,(H,19,21) |
| InChIKey | SAAGRDCLUWCKRU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.27 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |