C20H26N4O — CID 109126367
6-(azepan-1-yl)-N-(2-ethyl-6-methylphenyl)pyridazine-3-carboxamide (PubChem CID 109126367) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is 6-(azepan-1-yl)-N-(2-ethyl-6-methylphenyl)pyridazine-3-carboxamide.
| Compound Name | 6-(azepan-1-yl)-N-(2-ethyl-6-methylphenyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109126367 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 6-(azepan-1-yl)-N-(2-ethyl-6-methylphenyl)pyridazine-3-carboxamide |
| SMILES | CCc1cccc(C)c1NC(=O)c1ccc(N2CCCCCC2)nn1 |
| InChI | InChI=1S/C20H26N4O/c1-3-16-10-8-9-15(2)19(16)21-20(25)17-11-12-18(23-22-17)24-13-6-4-5-7-14-24/h8-12H,3-7,13-14H2,1-2H3,(H,21,25) |
| InChIKey | VMWLDUYTFJOFOP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |