About 4,5-bis(4-fluorophenyl)-2-methyl-3H-1,2-oxazole
4,5-bis(4-fluorophenyl)-2-methyl-3H-1,2-oxazole (PubChem CID 10912676) has the molecular formula C16H13F2NO
and a molecular weight of 273.28 g/mol. Its IUPAC name is 4,5-bis(4-fluorophenyl)-2-methyl-3H-1,2-oxazole.
Molecular Properties
| Compound Name | 4,5-bis(4-fluorophenyl)-2-methyl-3H-1,2-oxazole |
| PubChem CID | 10912676 |
| Molecular Formula | C16H13F2NO |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 4,5-bis(4-fluorophenyl)-2-methyl-3H-1,2-oxazole |
| SMILES | CN1CC(c2ccc(F)cc2)=C(c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C16H13F2NO/c1-19-10-15(11-2-6-13(17)7-3-11)16(20-19)12-4-8-14(18)9-5-12/h2-9H,10H2,1H3 |
| InChIKey | HYECUMBELHFSOE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4,5-bis(4-fluorophenyl)-2-methyl-3H-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(4-fluorophenyl)-2-methyl-3H-1,2-oxazole?
The IUPAC name of 4,5-bis(4-fluorophenyl)-2-methyl-3H-1,2-oxazole (CID 10912676) is 4,5-bis(4-fluorophenyl)-2-methyl-3H-1,2-oxazole.
What is the SMILES notation for 4,5-bis(4-fluorophenyl)-2-methyl-3H-1,2-oxazole?
The canonical SMILES for 4,5-bis(4-fluorophenyl)-2-methyl-3H-1,2-oxazole is CN1CC(c2ccc(F)cc2)=C(c2ccc(F)cc2)O1.
What is the InChIKey of 4,5-bis(4-fluorophenyl)-2-methyl-3H-1,2-oxazole?
The InChIKey is HYECUMBELHFSOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13F2NO/c1-19-10-15(11-2-6-13(17)7-3-11)16(20-19)12-4-8-14(18)9-5-12/h2-9H,10H2,1H3.
What are the key properties of 4,5-bis(4-fluorophenyl)-2-methyl-3H-1,2-oxazole?
4,5-bis(4-fluorophenyl)-2-methyl-3H-1,2-oxazole has a molecular weight of 273.28 g/mol, XLogP of 3.71, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(4-fluorophenyl)-2-methyl-3H-1,2-oxazole is sourced from PubChem (CID 10912676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).