C15H15NO4 — CID 10912680
1-[(E)-2-nitroethenyl]-7,8,9,10-tetrahydro-6H-cyclohepta[b][1]benzofuran-2-ol (PubChem CID 10912680) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is 1-[(E)-2-nitroethenyl]-7,8,9,10-tetrahydro-6H-cyclohepta[b][1]benzofuran-2-ol.
| Compound Name | 1-[(E)-2-nitroethenyl]-7,8,9,10-tetrahydro-6H-cyclohepta[b][1]benzofuran-2-ol |
|---|---|
| PubChem CID | 10912680 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 1-[(E)-2-nitroethenyl]-7,8,9,10-tetrahydro-6H-cyclohepta[b][1]benzofuran-2-ol |
| SMILES | O=[N+]([O-])/C=C/c1c(O)ccc2oc3c(c12)CCCCC3 |
| InChI | InChI=1S/C15H15NO4/c17-12-6-7-14-15(10(12)8-9-16(18)19)11-4-2-1-3-5-13(11)20-14/h6-9,17H,1-5H2/b9-8+ |
| InChIKey | KHGVJDSZPAFRLG-CMDGGOBGSA-N |
| XLogP | 3.65 |
| TPSA | 76.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|