C20H17N5O — CID 109127539
N-(3-cyanophenyl)-6-(2,4-dimethylanilino)pyridazine-3-carboxamide (PubChem CID 109127539) has the molecular formula C20H17N5O and a molecular weight of 343.39 g/mol. Its IUPAC name is N-(3-cyanophenyl)-6-(2,4-dimethylanilino)pyridazine-3-carboxamide.
| Compound Name | N-(3-cyanophenyl)-6-(2,4-dimethylanilino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109127539 |
| Molecular Formula | C20H17N5O |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | N-(3-cyanophenyl)-6-(2,4-dimethylanilino)pyridazine-3-carboxamide |
| SMILES | Cc1ccc(Nc2ccc(C(=O)Nc3cccc(C#N)c3)nn2)c(C)c1 |
| InChI | InChI=1S/C20H17N5O/c1-13-6-7-17(14(2)10-13)23-19-9-8-18(24-25-19)20(26)22-16-5-3-4-15(11-16)12-21/h3-11H,1-2H3,(H,22,26)(H,23,25) |
| InChIKey | JRFWNYILKYFOML-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |