C22H22N4O3 — CID 109127759
ethyl 4-[[6-[(3,5-dimethylphenyl)carbamoyl]pyridazin-3-yl]amino]benzoate (PubChem CID 109127759) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is ethyl 4-[[6-[(3,5-dimethylphenyl)carbamoyl]pyridazin-3-yl]amino]benzoate.
| Compound Name | ethyl 4-[[6-[(3,5-dimethylphenyl)carbamoyl]pyridazin-3-yl]amino]benzoate |
|---|---|
| PubChem CID | 109127759 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | ethyl 4-[[6-[(3,5-dimethylphenyl)carbamoyl]pyridazin-3-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2ccc(C(=O)Nc3cc(C)cc(C)c3)nn2)cc1 |
| InChI | InChI=1S/C22H22N4O3/c1-4-29-22(28)16-5-7-17(8-6-16)23-20-10-9-19(25-26-20)21(27)24-18-12-14(2)11-15(3)13-18/h5-13H,4H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | SGIKJOWADOSIKK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |