C12H26O5Si — CID 10912867
methyl (2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)propanoate (PubChem CID 10912867) has the molecular formula C12H26O5Si and a molecular weight of 278.42 g/mol. Its IUPAC name is methyl (2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)propanoate.
| Compound Name | methyl (2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)propanoate |
|---|---|
| PubChem CID | 10912867 |
| Molecular Formula | C12H26O5Si |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | methyl (2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)propanoate |
| SMILES | COCO[C@@H](CO[Si](C)(C)C(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C12H26O5Si/c1-12(2,3)18(6,7)17-8-10(11(13)15-5)16-9-14-4/h10H,8-9H2,1-7H3/t10-/m0/s1 |
| InChIKey | VOIATFLUBUNEDC-JTQLQIEISA-N |
| XLogP | 2.17 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|