C21H16ClN5O — CID 109128991
N-(3-chloro-4-methylphenyl)-6-(quinolin-8-ylamino)pyridazine-3-carboxamide (PubChem CID 109128991) has the molecular formula C21H16ClN5O and a molecular weight of 389.85 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-6-(quinolin-8-ylamino)pyridazine-3-carboxamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-6-(quinolin-8-ylamino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109128991 |
| Molecular Formula | C21H16ClN5O |
| Molecular Weight | 389.85 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-6-(quinolin-8-ylamino)pyridazine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(Nc3cccc4cccnc34)nn2)cc1Cl |
| InChI | InChI=1S/C21H16ClN5O/c1-13-7-8-15(12-16(13)22)24-21(28)18-9-10-19(27-26-18)25-17-6-2-4-14-5-3-11-23-20(14)17/h2-12H,1H3,(H,24,28)(H,25,27) |
| InChIKey | XQGMBQBHGKALEZ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.85 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |