C19H17FN4O3 — CID 109129697
N-(2,4-dimethoxyphenyl)-6-(3-fluoroanilino)pyridazine-3-carboxamide (PubChem CID 109129697) has the molecular formula C19H17FN4O3 and a molecular weight of 368.37 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-6-(3-fluoroanilino)pyridazine-3-carboxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-6-(3-fluoroanilino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109129697 |
| Molecular Formula | C19H17FN4O3 |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-6-(3-fluoroanilino)pyridazine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc(Nc3cccc(F)c3)nn2)c(OC)c1 |
| InChI | InChI=1S/C19H17FN4O3/c1-26-14-6-7-15(17(11-14)27-2)22-19(25)16-8-9-18(24-23-16)21-13-5-3-4-12(20)10-13/h3-11H,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | MZQPNSQDPDQZHV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |