C19H14F2N4O3 — CID 109129957
methyl 3-[[6-[(3,4-difluorophenyl)carbamoyl]pyridazin-3-yl]amino]benzoate (PubChem CID 109129957) has the molecular formula C19H14F2N4O3 and a molecular weight of 384.34 g/mol. Its IUPAC name is methyl 3-[[6-[(3,4-difluorophenyl)carbamoyl]pyridazin-3-yl]amino]benzoate.
| Compound Name | methyl 3-[[6-[(3,4-difluorophenyl)carbamoyl]pyridazin-3-yl]amino]benzoate |
|---|---|
| PubChem CID | 109129957 |
| Molecular Formula | C19H14F2N4O3 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | methyl 3-[[6-[(3,4-difluorophenyl)carbamoyl]pyridazin-3-yl]amino]benzoate |
| SMILES | COC(=O)c1cccc(Nc2ccc(C(=O)Nc3ccc(F)c(F)c3)nn2)c1 |
| InChI | InChI=1S/C19H14F2N4O3/c1-28-19(27)11-3-2-4-12(9-11)22-17-8-7-16(24-25-17)18(26)23-13-5-6-14(20)15(21)10-13/h2-10H,1H3,(H,22,25)(H,23,26) |
| InChIKey | OSDQRULZGKZQBO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |