C18H12FN5O — CID 109130101
N-(4-cyanophenyl)-6-(3-fluoroanilino)pyridazine-3-carboxamide (PubChem CID 109130101) has the molecular formula C18H12FN5O and a molecular weight of 333.33 g/mol. Its IUPAC name is N-(4-cyanophenyl)-6-(3-fluoroanilino)pyridazine-3-carboxamide.
| Compound Name | N-(4-cyanophenyl)-6-(3-fluoroanilino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109130101 |
| Molecular Formula | C18H12FN5O |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | N-(4-cyanophenyl)-6-(3-fluoroanilino)pyridazine-3-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)c2ccc(Nc3cccc(F)c3)nn2)cc1 |
| InChI | InChI=1S/C18H12FN5O/c19-13-2-1-3-15(10-13)21-17-9-8-16(23-24-17)18(25)22-14-6-4-12(11-20)5-7-14/h1-10H,(H,21,24)(H,22,25) |
| InChIKey | YCCGEKTVBBJPAO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |