C13H15ClN2O3 — CID 10913011
2-chloro-N-[2-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]ethyl]acetamide (PubChem CID 10913011) has the molecular formula C13H15ClN2O3 and a molecular weight of 282.73 g/mol. Its IUPAC name is 2-chloro-N-[2-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]ethyl]acetamide.
| Compound Name | 2-chloro-N-[2-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 10913011 |
| Molecular Formula | C13H15ClN2O3 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 2-chloro-N-[2-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]ethyl]acetamide |
| SMILES | O=C(CCl)NCCN1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C13H15ClN2O3/c14-6-9(17)15-3-4-16-12(18)10-7-1-2-8(5-7)11(10)13(16)19/h1-2,7-8,10-11H,3-6H2,(H,15,17)/t7-,8+,10+,11- |
| InChIKey | MIMSFBQHQNGYSV-YDRMRZIKSA-N |
| XLogP | 0.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|