About [1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-methyl-3-oxopiperazin-2-ylidene]cyanamide
[1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-methyl-3-oxopiperazin-2-ylidene]cyanamide (PubChem CID 10913029) has the molecular formula C10H10ClN5OS
and a molecular weight of 283.74 g/mol. Its IUPAC name is [1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-methyl-3-oxopiperazin-2-ylidene]cyanamide.
Molecular Properties
| Compound Name | [1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-methyl-3-oxopiperazin-2-ylidene]cyanamide |
| PubChem CID | 10913029 |
| Molecular Formula | C10H10ClN5OS |
| Molecular Weight | 283.74 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | [1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-methyl-3-oxopiperazin-2-ylidene]cyanamide |
| SMILES | CN1CCN(Cc2cnc(Cl)s2)/C(=N/C#N)C1=O |
| InChI | InChI=1S/C10H10ClN5OS/c1-15-2-3-16(8(9(15)17)14-6-12)5-7-4-13-10(11)18-7/h4H,2-3,5H2,1H3/b14-8+ |
| InChIKey | VBRKFTSGUXSHIC-RIYZIHGNSA-N |
| XLogP | 0.95 |
| TPSA | 72.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.74 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-methyl-3-oxopiperazin-2-ylidene]cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-methyl-3-oxopiperazin-2-ylidene]cyanamide?
The IUPAC name of [1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-methyl-3-oxopiperazin-2-ylidene]cyanamide (CID 10913029) is [1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-methyl-3-oxopiperazin-2-ylidene]cyanamide.
What is the SMILES notation for [1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-methyl-3-oxopiperazin-2-ylidene]cyanamide?
The canonical SMILES for [1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-methyl-3-oxopiperazin-2-ylidene]cyanamide is CN1CCN(Cc2cnc(Cl)s2)/C(=N/C#N)C1=O.
What is the InChIKey of [1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-methyl-3-oxopiperazin-2-ylidene]cyanamide?
The InChIKey is VBRKFTSGUXSHIC-RIYZIHGNSA-N. The full InChI is InChI=1S/C10H10ClN5OS/c1-15-2-3-16(8(9(15)17)14-6-12)5-7-4-13-10(11)18-7/h4H,2-3,5H2,1H3/b14-8+.
What are the key properties of [1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-methyl-3-oxopiperazin-2-ylidene]cyanamide?
[1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-methyl-3-oxopiperazin-2-ylidene]cyanamide has a molecular weight of 283.74 g/mol, XLogP of 0.95, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-methyl-3-oxopiperazin-2-ylidene]cyanamide is sourced from PubChem (CID 10913029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).