C31H34F2O6 — CID 109130355
3-O-tert-butyl 1-O,1-O'-dipropan-2-yl (2R,3S)-7-fluoro-2-(3-fluorophenyl)-3-prop-2-ynyl-2H-indene-1,1,3-tricarboxylate (PubChem CID 109130355) has the molecular formula C31H34F2O6 and a molecular weight of 540.60 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O,1-O'-dipropan-2-yl (2R,3S)-7-fluoro-2-(3-fluorophenyl)-3-prop-2-ynyl-2H-indene-1,1,3-tricarboxylate.
| Compound Name | 3-O-tert-butyl 1-O,1-O'-dipropan-2-yl (2R,3S)-7-fluoro-2-(3-fluorophenyl)-3-prop-2-ynyl-2H-indene-1,1,3-tricarboxylate |
|---|---|
| PubChem CID | 109130355 |
| Molecular Formula | C31H34F2O6 |
| Molecular Weight | 540.60 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | 3-O-tert-butyl 1-O,1-O'-dipropan-2-yl (2R,3S)-7-fluoro-2-(3-fluorophenyl)-3-prop-2-ynyl-2H-indene-1,1,3-tricarboxylate |
| SMILES | C#CC[C@@]1(C(=O)OC(C)(C)C)c2cccc(F)c2C(C(=O)OC(C)C)(C(=O)OC(C)C)[C@@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C31H34F2O6/c1-9-16-30(26(34)39-29(6,7)8)22-14-11-15-23(33)24(22)31(27(35)37-18(2)3,28(36)38-19(4)5)25(30)20-12-10-13-21(32)17-20/h1,10-15,17-19,25H,16H2,2-8H3/t25-,30-/m1/s1 |
| InChIKey | KKDKIXQFSAQSKW-FYBSXPHGSA-N |
| XLogP | 5.51 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.60 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|