C15H28O3Si — CID 10913071
2-[(2S,3S,5Z)-3-[tert-butyl(dimethyl)silyl]oxy-3,4,7,8-tetrahydro-2H-oxocin-2-yl]acetaldehyde (PubChem CID 10913071) has the molecular formula C15H28O3Si and a molecular weight of 284.47 g/mol. Its IUPAC name is 2-[(2S,3S,5Z)-3-[tert-butyl(dimethyl)silyl]oxy-3,4,7,8-tetrahydro-2H-oxocin-2-yl]acetaldehyde.
| Compound Name | 2-[(2S,3S,5Z)-3-[tert-butyl(dimethyl)silyl]oxy-3,4,7,8-tetrahydro-2H-oxocin-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 10913071 |
| Molecular Formula | C15H28O3Si |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 2-[(2S,3S,5Z)-3-[tert-butyl(dimethyl)silyl]oxy-3,4,7,8-tetrahydro-2H-oxocin-2-yl]acetaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C/C=C\CCO[C@H]1CC=O |
| InChI | InChI=1S/C15H28O3Si/c1-15(2,3)19(4,5)18-14-9-7-6-8-12-17-13(14)10-11-16/h6-7,11,13-14H,8-10,12H2,1-5H3/b7-6-/t13-,14-/m0/s1 |
| InChIKey | ZRDTWPCKEWRQHQ-KFBXHMBNSA-N |
| XLogP | 3.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|