C13H22N2O2 — CID 109131092
1-N-butyl-1-N-methyl-2-N-prop-2-enylcyclopropane-1,2-dicarboxamide (PubChem CID 109131092) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-N-butyl-1-N-methyl-2-N-prop-2-enylcyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N-butyl-1-N-methyl-2-N-prop-2-enylcyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109131092 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 1-N-butyl-1-N-methyl-2-N-prop-2-enylcyclopropane-1,2-dicarboxamide |
| SMILES | C=CCNC(=O)C1CC1C(=O)N(C)CCCC |
| InChI | InChI=1S/C13H22N2O2/c1-4-6-8-15(3)13(17)11-9-10(11)12(16)14-7-5-2/h5,10-11H,2,4,6-9H2,1,3H3,(H,14,16) |
| InChIKey | ZHFAOENARLCOAU-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|