C18H29NO2 — CID 10913314
methyl (2E,6E)-4-(dimethylamino)-2,6-dimethyl-10-methylidenedodeca-2,6,11-trienoate (PubChem CID 10913314) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is methyl (2E,6E)-4-(dimethylamino)-2,6-dimethyl-10-methylidenedodeca-2,6,11-trienoate.
| Compound Name | methyl (2E,6E)-4-(dimethylamino)-2,6-dimethyl-10-methylidenedodeca-2,6,11-trienoate |
|---|---|
| PubChem CID | 10913314 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | methyl (2E,6E)-4-(dimethylamino)-2,6-dimethyl-10-methylidenedodeca-2,6,11-trienoate |
| SMILES | C=CC(=C)CC/C=C(\C)CC(/C=C(\C)C(=O)OC)N(C)C |
| InChI | InChI=1S/C18H29NO2/c1-8-14(2)10-9-11-15(3)12-17(19(5)6)13-16(4)18(20)21-7/h8,11,13,17H,1-2,9-10,12H2,3-7H3/b15-11+,16-13+ |
| InChIKey | VXJDTHUXAOYIBF-NWFDBUFXSA-N |
| XLogP | 3.89 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|