C21H29N3O3 — CID 109133590
2-N-(oxolan-2-ylmethyl)-1-N-(4-piperidin-1-ylphenyl)cyclopropane-1,2-dicarboxamide (PubChem CID 109133590) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is 2-N-(oxolan-2-ylmethyl)-1-N-(4-piperidin-1-ylphenyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | 2-N-(oxolan-2-ylmethyl)-1-N-(4-piperidin-1-ylphenyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109133590 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 2-N-(oxolan-2-ylmethyl)-1-N-(4-piperidin-1-ylphenyl)cyclopropane-1,2-dicarboxamide |
| SMILES | O=C(NCC1CCCO1)C1CC1C(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C21H29N3O3/c25-20(22-14-17-5-4-12-27-17)18-13-19(18)21(26)23-15-6-8-16(9-7-15)24-10-2-1-3-11-24/h6-9,17-19H,1-5,10-14H2,(H,22,25)(H,23,26) |
| InChIKey | SNPXLXFBUCYBIG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|