About 3,3-dimethyl-1-[(2S)-2-pentanoylpiperidin-1-yl]pentane-1,2-dione
3,3-dimethyl-1-[(2S)-2-pentanoylpiperidin-1-yl]pentane-1,2-dione (PubChem CID 10913447) has the molecular formula C17H29NO3
and a molecular weight of 295.42 g/mol. Its IUPAC name is 3,3-dimethyl-1-[(2S)-2-pentanoylpiperidin-1-yl]pentane-1,2-dione.
Molecular Properties
| Compound Name | 3,3-dimethyl-1-[(2S)-2-pentanoylpiperidin-1-yl]pentane-1,2-dione |
| PubChem CID | 10913447 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 3,3-dimethyl-1-[(2S)-2-pentanoylpiperidin-1-yl]pentane-1,2-dione |
| SMILES | CCCCC(=O)[C@@H]1CCCCN1C(=O)C(=O)C(C)(C)CC |
| InChI | InChI=1S/C17H29NO3/c1-5-7-11-14(19)13-10-8-9-12-18(13)16(21)15(20)17(3,4)6-2/h13H,5-12H2,1-4H3/t13-/m0/s1 |
| InChIKey | ABWVHMRPSGGLNQ-ZDUSSCGKSA-N |
| XLogP | 3.13 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethyl-1-[(2S)-2-pentanoylpiperidin-1-yl]pentane-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-1-[(2S)-2-pentanoylpiperidin-1-yl]pentane-1,2-dione?
The IUPAC name of 3,3-dimethyl-1-[(2S)-2-pentanoylpiperidin-1-yl]pentane-1,2-dione (CID 10913447) is 3,3-dimethyl-1-[(2S)-2-pentanoylpiperidin-1-yl]pentane-1,2-dione.
What is the SMILES notation for 3,3-dimethyl-1-[(2S)-2-pentanoylpiperidin-1-yl]pentane-1,2-dione?
The canonical SMILES for 3,3-dimethyl-1-[(2S)-2-pentanoylpiperidin-1-yl]pentane-1,2-dione is CCCCC(=O)[C@@H]1CCCCN1C(=O)C(=O)C(C)(C)CC.
What is the InChIKey of 3,3-dimethyl-1-[(2S)-2-pentanoylpiperidin-1-yl]pentane-1,2-dione?
The InChIKey is ABWVHMRPSGGLNQ-ZDUSSCGKSA-N. The full InChI is InChI=1S/C17H29NO3/c1-5-7-11-14(19)13-10-8-9-12-18(13)16(21)15(20)17(3,4)6-2/h13H,5-12H2,1-4H3/t13-/m0/s1.
What are the key properties of 3,3-dimethyl-1-[(2S)-2-pentanoylpiperidin-1-yl]pentane-1,2-dione?
3,3-dimethyl-1-[(2S)-2-pentanoylpiperidin-1-yl]pentane-1,2-dione has a molecular weight of 295.42 g/mol, XLogP of 3.13, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-1-[(2S)-2-pentanoylpiperidin-1-yl]pentane-1,2-dione is sourced from PubChem (CID 10913447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).