C20H27N3O3 — CID 109134564
N-(2,6-diethylphenyl)-2-(4-formylpiperazine-1-carbonyl)cyclopropane-1-carboxamide (PubChem CID 109134564) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-2-(4-formylpiperazine-1-carbonyl)cyclopropane-1-carboxamide.
| Compound Name | N-(2,6-diethylphenyl)-2-(4-formylpiperazine-1-carbonyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 109134564 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | N-(2,6-diethylphenyl)-2-(4-formylpiperazine-1-carbonyl)cyclopropane-1-carboxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)C1CC1C(=O)N1CCN(C=O)CC1 |
| InChI | InChI=1S/C20H27N3O3/c1-3-14-6-5-7-15(4-2)18(14)21-19(25)16-12-17(16)20(26)23-10-8-22(13-24)9-11-23/h5-7,13,16-17H,3-4,8-12H2,1-2H3,(H,21,25) |
| InChIKey | HLAOPBFMGDYWML-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|