C15H32O4Si — CID 10913746
[(2S,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethylpentyl] acetate (PubChem CID 10913746) has the molecular formula C15H32O4Si and a molecular weight of 304.50 g/mol. Its IUPAC name is [(2S,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethylpentyl] acetate.
| Compound Name | [(2S,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethylpentyl] acetate |
|---|---|
| PubChem CID | 10913746 |
| Molecular Formula | C15H32O4Si |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.21 |
| IUPAC Name | [(2S,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethylpentyl] acetate |
| SMILES | CC(=O)OC[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)CO |
| InChI | InChI=1S/C15H32O4Si/c1-11(9-16)14(12(2)10-18-13(3)17)19-20(7,8)15(4,5)6/h11-12,14,16H,9-10H2,1-8H3/t11-,12+,14-/m1/s1 |
| InChIKey | MEHDIGFBCQHONT-MBNYWOFBSA-N |
| XLogP | 3.20 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|